Products 1440955-19-0

CAS 1440955-19-0 is the registry number for 1-[(1,1-Dimethylethoxy)carbonyl]hexahydro-5-oxo-1H-azepine-4-acetic acid, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g.

Structural formula: {0} (CAS {1})

2-[1-[(2-methylpropan-2-yl)oxycarbonyl]-5-oxoazepan-4-yl]acetic acid (CAS 1440955-19-0) is a chemical compound with the molecular formula C13H21NO5 and a molecular weight of 271.31 g/mol. IUPAC name: 2-[1-[(2-methylpropan-2-yl)oxycarbonyl]-5-oxoazepan-4-yl]acetic acid. InChIKey: OSINEUGRWRMBIN-UHFFFAOYSA-N.

Identity
Molecular formulaC13H21NO5
Molecular weight271.31 g/mol
IUPAC name2-[1-[(2-methylpropan-2-yl)oxycarbonyl]-5-oxoazepan-4-yl]acetic acid
InChIKeyOSINEUGRWRMBIN-UHFFFAOYSA-N
SMILESCC(C)(C)OC(=O)N1CCC(C(=O)CC1)CC(=O)O

Computed by PubChem (NCBI)