CAS 144172-51-0 is the registry number for 4,5-Dichloro-2-(2-phenoxyethyl)-2,3-dihydropyridazin-3-one. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
4,5-dichloro-2-(2-phenoxyethyl)pyridazin-3-one (CAS 144172-51-0) is a chemical compound with the molecular formula C12H10Cl2N2O2 and a molecular weight of 285.12 g/mol. IUPAC name: 4,5-dichloro-2-(2-phenoxyethyl)pyridazin-3-one. InChIKey: BMFWQHIIOLHLTO-UHFFFAOYSA-N.
| Molecular formula | C12H10Cl2N2O2 |
|---|---|
| Molecular weight | 285.12 g/mol |
| IUPAC name | 4,5-dichloro-2-(2-phenoxyethyl)pyridazin-3-one |
| InChIKey | BMFWQHIIOLHLTO-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)OCCN2C(=O)C(=C(C=N2)Cl)Cl |
Computed by PubChem (NCBI)