CAS 92574-75-9 is the registry number for 2-((Benzyloxy)methyl)-4,5-dichloropyridazin-3(2H)-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
4,5-dichloro-2-(phenylmethoxymethyl)pyridazin-3-one (CAS 92574-75-9) is a chemical compound with the molecular formula C12H10Cl2N2O2 and a molecular weight of 285.12 g/mol. IUPAC name: 4,5-dichloro-2-(phenylmethoxymethyl)pyridazin-3-one. InChIKey: HMPOUYCZGZBFOK-UHFFFAOYSA-N.
| Molecular formula | C12H10Cl2N2O2 |
|---|---|
| Molecular weight | 285.12 g/mol |
| IUPAC name | 4,5-dichloro-2-(phenylmethoxymethyl)pyridazin-3-one |
| InChIKey | HMPOUYCZGZBFOK-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COCN2C(=O)C(=C(C=N2)Cl)Cl |
Computed by PubChem (NCBI)