CAS 393860-82-7 is the registry number for 3,5-Dichloro-1-[(4-methoxyphenyl)-methyl]-1,2-dihydropyrazin-2-one, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g.
3,5-dichloro-1-[(4-methoxyphenyl)methyl]pyrazin-2-one (CAS 393860-82-7) is a chemical compound with the molecular formula C12H10Cl2N2O2 and a molecular weight of 285.12 g/mol. IUPAC name: 3,5-dichloro-1-[(4-methoxyphenyl)methyl]pyrazin-2-one. InChIKey: JPKUSSSGPZHYCR-UHFFFAOYSA-N.
| Molecular formula | C12H10Cl2N2O2 |
|---|---|
| Molecular weight | 285.12 g/mol |
| IUPAC name | 3,5-dichloro-1-[(4-methoxyphenyl)methyl]pyrazin-2-one |
| InChIKey | JPKUSSSGPZHYCR-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)CN2C=C(N=C(C2=O)Cl)Cl |
Computed by PubChem (NCBI)