Products 393860-82-7

CAS 393860-82-7 is the registry number for 3,5-Dichloro-1-[(4-methoxyphenyl)-methyl]-1,2-dihydropyrazin-2-one, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g.

Structural formula: {0} (CAS {1})

3,5-dichloro-1-[(4-methoxyphenyl)methyl]pyrazin-2-one (CAS 393860-82-7) is a chemical compound with the molecular formula C12H10Cl2N2O2 and a molecular weight of 285.12 g/mol. IUPAC name: 3,5-dichloro-1-[(4-methoxyphenyl)methyl]pyrazin-2-one. InChIKey: JPKUSSSGPZHYCR-UHFFFAOYSA-N.

Identity
Molecular formulaC12H10Cl2N2O2
Molecular weight285.12 g/mol
IUPAC name3,5-dichloro-1-[(4-methoxyphenyl)methyl]pyrazin-2-one
InChIKeyJPKUSSSGPZHYCR-UHFFFAOYSA-N
SMILESCOC1=CC=C(C=C1)CN2C=C(N=C(C2=O)Cl)Cl

Computed by PubChem (NCBI)