Products 1441930-90-0
CAS 1441930-90-0 is the registry number for 2-(4-Fluorophenyl)-5-methyl-4,5-dihydro-1H-imidazole, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-(4-fluorophenyl)-5-methyl-4,5-dihydro-1H-imidazole (CAS 1441930-90-0) is a chemical compound with the molecular formula C10H11FN2 and a molecular weight of 178.21 g/mol. IUPAC name: 2-(4-fluorophenyl)-5-methyl-4,5-dihydro-1H-imidazole. InChIKey: AXUOMOCKTRUGAL-UHFFFAOYSA-N.
| Molecular formula | C10H11FN2 |
|---|---|
| Molecular weight | 178.21 g/mol |
| IUPAC name | 2-(4-fluorophenyl)-5-methyl-4,5-dihydro-1H-imidazole |
| InChIKey | AXUOMOCKTRUGAL-UHFFFAOYSA-N |
| SMILES | CC1CN=C(N1)C2=CC=C(C=C2)F |
Computed by PubChem (NCBI)