CAS 2923978-41-8 is the registry number for (6S,9R)-4-Fluoro-6,7,8,9-tetrahydro-5H-6,9-epiminocyclohepta[b]pyridine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(1R,9S)-6-fluoro-3,12-diazatricyclo[7.2.1.02,7]dodeca-2,4,6-triene (CAS 2923978-41-8) is a chemical compound with the molecular formula C10H11FN2 and a molecular weight of 178.21 g/mol. IUPAC name: (1R,9S)-6-fluoro-3,12-diazatricyclo[7.2.1.02,7]dodeca-2,4,6-triene. InChIKey: MZIDDCOISAQMCX-IMTBSYHQSA-N.
| Molecular formula | C10H11FN2 |
|---|---|
| Molecular weight | 178.21 g/mol |
| IUPAC name | (1R,9S)-6-fluoro-3,12-diazatricyclo[7.2.1.02,7]dodeca-2,4,6-triene |
| InChIKey | MZIDDCOISAQMCX-IMTBSYHQSA-N |
| SMILES | C1C[C@@H]2C3=NC=CC(=C3C[C@H]1N2)F |
Computed by PubChem (NCBI)