Products 327079-38-9
CAS 327079-38-9 is the registry number for N-(4-Fluorophenyl)-3,4-dihydro-2H-pyrrol-5-amine, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
N-(4-fluorophenyl)-3,4-dihydro-2H-pyrrol-5-amine (CAS 327079-38-9) is a chemical compound with the molecular formula C10H11FN2 and a molecular weight of 178.21 g/mol. IUPAC name: N-(4-fluorophenyl)-3,4-dihydro-2H-pyrrol-5-amine. InChIKey: OHBJHSBVTSYECA-UHFFFAOYSA-N.
| Molecular formula | C10H11FN2 |
|---|---|
| Molecular weight | 178.21 g/mol |
| IUPAC name | N-(4-fluorophenyl)-3,4-dihydro-2H-pyrrol-5-amine |
| InChIKey | OHBJHSBVTSYECA-UHFFFAOYSA-N |
| SMILES | C1CC(=NC1)NC2=CC=C(C=C2)F |
Computed by PubChem (NCBI)