Products 1442-06-4

CAS 1442-06-4 is the registry number for 4-(Methylthio)benzoyl chloride, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 1g.

Structural formula: {0} (CAS {1})

4-methylsulfanylbenzoyl chloride (CAS 1442-06-4) is a chemical compound with the molecular formula C8H7ClOS and a molecular weight of 186.66 g/mol. IUPAC name: 4-methylsulfanylbenzoyl chloride. InChIKey: MIEJPWILCQAQKT-UHFFFAOYSA-N.

Identity
Molecular formulaC8H7ClOS
Molecular weight186.66 g/mol
IUPAC name4-methylsulfanylbenzoyl chloride
InChIKeyMIEJPWILCQAQKT-UHFFFAOYSA-N
SMILESCSC1=CC=C(C=C1)C(=O)Cl

Computed by PubChem (NCBI)