Products 19945-37-0
CAS 19945-37-0 is the registry number for 2-Chloro-5,6-dihydrobenzothiophen-7(4H)-one. Offered by: TRC. Available pack sizes: 100mg.
2-chloro-5,6-dihydro-4H-1-benzothiophen-7-one (CAS 19945-37-0) is a chemical compound with the molecular formula C8H7ClOS and a molecular weight of 186.66 g/mol. IUPAC name: 2-chloro-5,6-dihydro-4H-1-benzothiophen-7-one. InChIKey: HKGSMAJXWGOORV-UHFFFAOYSA-N.
| Molecular formula | C8H7ClOS |
|---|---|
| Molecular weight | 186.66 g/mol |
| IUPAC name | 2-chloro-5,6-dihydro-4H-1-benzothiophen-7-one |
| InChIKey | HKGSMAJXWGOORV-UHFFFAOYSA-N |
| SMILES | C1CC2=C(C(=O)C1)SC(=C2)Cl |
Computed by PubChem (NCBI)