CAS 22168-07-6 is the registry number for 2-Chloro-6,7-dihydrobenzo(b)thiophen-4(5H)-one, 95+%. Offered by: AmBeed. Available pack sizes: 1g.
2-chloro-6,7-dihydro-5H-1-benzothiophen-4-one (CAS 22168-07-6) is a chemical compound with the molecular formula C8H7ClOS and a molecular weight of 186.66 g/mol. IUPAC name: 2-chloro-6,7-dihydro-5H-1-benzothiophen-4-one. InChIKey: NOCJHRKCNWTHIC-UHFFFAOYSA-N.
| Molecular formula | C8H7ClOS |
|---|---|
| Molecular weight | 186.66 g/mol |
| IUPAC name | 2-chloro-6,7-dihydro-5H-1-benzothiophen-4-one |
| InChIKey | NOCJHRKCNWTHIC-UHFFFAOYSA-N |
| SMILES | C1CC2=C(C=C(S2)Cl)C(=O)C1 |
Computed by PubChem (NCBI)