CAS 144207-41-0 appears in our catalog under these names: (S)-2-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)-5,5,5-trifluoropentanoic acid, 95%, N-Fmoc-5,5,5-trifluoro-L-norvaline, N–Fmoc–5,5,5–trifluoro–L–norvaline, Fmoc-L-TfNva-OH, Fmoc-Nva(5,5,5-triF)-OH 98%. Offered by: Combi-blocks, TargetMol, GLPBio, Iris Biotech, Ambeed. Available pack sizes: 250mg, 100mg, 1g, 5mg, 10mg, 5g, 100 mg, 250 mg.
(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-5,5,5-trifluoropentanoic acid (CAS 144207-41-0) is a chemical compound with the molecular formula C20H18F3NO4 and a molecular weight of 393.4 g/mol. IUPAC name: (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-5,5,5-trifluoropentanoic acid. InChIKey: KMHCZJHUIDEERF-KRWDZBQOSA-N.
| Molecular formula | C20H18F3NO4 |
|---|---|
| Molecular weight | 393.4 g/mol |
| IUPAC name | (2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-5,5,5-trifluoropentanoic acid |
| InChIKey | KMHCZJHUIDEERF-KRWDZBQOSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)N[C@@H](CCC(F)(F)F)C(=O)O |
Computed by PubChem (NCBI)