CAS 144207-42-1 is the registry number for Fmoc-D-Nva(5,5,5-triF)-OH 98%. Offered by: Ambeed. Available pack sizes: 50mg, 100mg, 250mg, 1g, 5g.
(2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-5,5,5-trifluoropentanoic acid (CAS 144207-42-1) is a chemical compound with the molecular formula C20H18F3NO4 and a molecular weight of 393.4 g/mol. IUPAC name: (2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-5,5,5-trifluoropentanoic acid. InChIKey: KMHCZJHUIDEERF-QGZVFWFLSA-N.
| Molecular formula | C20H18F3NO4 |
|---|---|
| Molecular weight | 393.4 g/mol |
| IUPAC name | (2R)-2-(9H-fluoren-9-ylmethoxycarbonylamino)-5,5,5-trifluoropentanoic acid |
| InChIKey | KMHCZJHUIDEERF-QGZVFWFLSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)N[C@H](CCC(F)(F)F)C(=O)O |
Computed by PubChem (NCBI)