CAS 2375258-67-4 is the registry number for 2-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)-5,5,5-trifluoropentanoic acid. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
2-(9H-fluoren-9-ylmethoxycarbonylamino)-5,5,5-trifluoropentanoic acid (CAS 2375258-67-4) is a chemical compound with the molecular formula C20H18F3NO4 and a molecular weight of 393.4 g/mol. IUPAC name: 2-(9H-fluoren-9-ylmethoxycarbonylamino)-5,5,5-trifluoropentanoic acid. InChIKey: KMHCZJHUIDEERF-UHFFFAOYSA-N.
| Molecular formula | C20H18F3NO4 |
|---|---|
| Molecular weight | 393.4 g/mol |
| IUPAC name | 2-(9H-fluoren-9-ylmethoxycarbonylamino)-5,5,5-trifluoropentanoic acid |
| InChIKey | KMHCZJHUIDEERF-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)NC(CCC(F)(F)F)C(=O)O |
Computed by PubChem (NCBI)