Products 1443279-59-1
CAS 1443279-59-1 appears in our catalog under these names: 2-Ethyl-5-(trifluoromethyl)pyrazole-3-carbaldehyde, 95%, 1-Ethyl-3-(trifluoromethyl)-1H-pyrazole-5-carbaldehyde. Offered by: Combi-blocks, Biosynth. Available pack sizes: 1g, 5g, 100mg.
1-ethyl-3-(trifluoromethyl)pyrazole-5-carbaldehyde (CAS 1443279-59-1) is a chemical compound with the molecular formula C7H7F3N2O and a molecular weight of 192.14 g/mol. IUPAC name: 1-ethyl-3-(trifluoromethyl)pyrazole-5-carbaldehyde. InChIKey: ZSWKBVVPDPLSRV-UHFFFAOYSA-N.
| Molecular formula | C7H7F3N2O |
|---|---|
| Molecular weight | 192.14 g/mol |
| IUPAC name | 1-ethyl-3-(trifluoromethyl)pyrazole-5-carbaldehyde |
| InChIKey | ZSWKBVVPDPLSRV-UHFFFAOYSA-N |
| SMILES | CCN1C(=CC(=N1)C(F)(F)F)C=O |
Computed by PubChem (NCBI)