Products 1443336-44-4

CAS 1443336-44-4 is the registry number for Ethyl 4-(2-(trifluoromethyl)-phenoxy)butanoate. Offered by: Biosynth. Available pack sizes: 10000mg, 5000mg.

Structural formula: {0} (CAS {1})

Ethyl 4-[2-(trifluoromethyl)phenoxy]butanoate (CAS 1443336-44-4) is a chemical compound with the molecular formula C13H15F3O3 and a molecular weight of 276.25 g/mol. IUPAC name: ethyl 4-[2-(trifluoromethyl)phenoxy]butanoate. InChIKey: XBWQHOIGKRQHKW-UHFFFAOYSA-N.

Identity
Molecular formulaC13H15F3O3
Molecular weight276.25 g/mol
IUPAC nameethyl 4-[2-(trifluoromethyl)phenoxy]butanoate
InChIKeyXBWQHOIGKRQHKW-UHFFFAOYSA-N
SMILESCCOC(=O)CCCOC1=CC=CC=C1C(F)(F)F

Computed by PubChem (NCBI)