Products 2755718-03-5
CAS 2755718-03-5 is the registry number for Ethyl 3-hydroxy-3-(2-methyl-4-(trifluoromethyl)phenyl)propanoate, ≥95%, ≥95%. Offered by: Chemat. Available pack sizes: 1g.
Ethyl 3-hydroxy-3-[2-methyl-4-(trifluoromethyl)phenyl]propanoate (CAS 2755718-03-5) is a chemical compound with the molecular formula C13H15F3O3 and a molecular weight of 276.25 g/mol. IUPAC name: ethyl 3-hydroxy-3-[2-methyl-4-(trifluoromethyl)phenyl]propanoate. InChIKey: LWXZUTLXKDWGBZ-UHFFFAOYSA-N.
| Molecular formula | C13H15F3O3 |
|---|---|
| Molecular weight | 276.25 g/mol |
| IUPAC name | ethyl 3-hydroxy-3-[2-methyl-4-(trifluoromethyl)phenyl]propanoate |
| InChIKey | LWXZUTLXKDWGBZ-UHFFFAOYSA-N |
| SMILES | CCOC(=O)CC(C1=C(C=C(C=C1)C(F)(F)F)C)O |
Computed by PubChem (NCBI)