Products 2270909-11-8

CAS 2270909-11-8 is the registry number for 2-[4-(2,2,2-Trifluoro-ethoxy)-benzyl]-butyric acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.

Structural formula: {0} (CAS {1})

2-[[4-(2,2,2-trifluoroethoxy)phenyl]methyl]butanoic acid (CAS 2270909-11-8) is a chemical compound with the molecular formula C13H15F3O3 and a molecular weight of 276.25 g/mol. IUPAC name: 2-[[4-(2,2,2-trifluoroethoxy)phenyl]methyl]butanoic acid. InChIKey: KSOIWMJQDLIUEB-UHFFFAOYSA-N.

Identity
Molecular formulaC13H15F3O3
Molecular weight276.25 g/mol
IUPAC name2-[[4-(2,2,2-trifluoroethoxy)phenyl]methyl]butanoic acid
InChIKeyKSOIWMJQDLIUEB-UHFFFAOYSA-N
SMILESCCC(CC1=CC=C(C=C1)OCC(F)(F)F)C(=O)O

Computed by PubChem (NCBI)