CAS 1443341-72-7 is the registry number for 1-(4-Fluoro-3,5-dimethylphenyl)-2-methylpropan-2-ol, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
1-(4-fluoro-3,5-dimethylphenyl)-2-methylpropan-2-ol (CAS 1443341-72-7) is a chemical compound with the molecular formula C12H17FO and a molecular weight of 196.26 g/mol. IUPAC name: 1-(4-fluoro-3,5-dimethylphenyl)-2-methylpropan-2-ol. InChIKey: NZGFASCHQCQNHY-UHFFFAOYSA-N.
| Molecular formula | C12H17FO |
|---|---|
| Molecular weight | 196.26 g/mol |
| IUPAC name | 1-(4-fluoro-3,5-dimethylphenyl)-2-methylpropan-2-ol |
| InChIKey | NZGFASCHQCQNHY-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=C1F)C)CC(C)(C)O |
Computed by PubChem (NCBI)