CAS 147611-05-0 is the registry number for α-(1,1-Dimethylethyl)-3-fluoro-α-methylbenzenemethanol, 95%, 95%. Offered by: Chemat. Available pack sizes: 50mg, 100mg.
2-(3-fluorophenyl)-3,3-dimethylbutan-2-ol (CAS 147611-05-0) is a chemical compound with the molecular formula C12H17FO and a molecular weight of 196.26 g/mol. IUPAC name: 2-(3-fluorophenyl)-3,3-dimethylbutan-2-ol. InChIKey: NMAZYWFJKOMRHW-UHFFFAOYSA-N.
| Molecular formula | C12H17FO |
|---|---|
| Molecular weight | 196.26 g/mol |
| IUPAC name | 2-(3-fluorophenyl)-3,3-dimethylbutan-2-ol |
| InChIKey | NMAZYWFJKOMRHW-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C(C)(C1=CC(=CC=C1)F)O |
Computed by PubChem (NCBI)