Products 2764729-83-9
CAS 2764729-83-9 is the registry number for 2-(Tert-butyl)-1-ethoxy-4-fluorobenzene, ≥95%, ≥95%. Offered by: Chemat. Available pack sizes: 1g.
2-tert-butyl-1-ethoxy-4-fluorobenzene (CAS 2764729-83-9) is a chemical compound with the molecular formula C12H17FO and a molecular weight of 196.26 g/mol. IUPAC name: 2-tert-butyl-1-ethoxy-4-fluorobenzene. InChIKey: ZAJYUZPNBGKYNL-UHFFFAOYSA-N.
| Molecular formula | C12H17FO |
|---|---|
| Molecular weight | 196.26 g/mol |
| IUPAC name | 2-tert-butyl-1-ethoxy-4-fluorobenzene |
| InChIKey | ZAJYUZPNBGKYNL-UHFFFAOYSA-N |
| SMILES | CCOC1=C(C=C(C=C1)F)C(C)(C)C |
Computed by PubChem (NCBI)