CAS 1443358-33-5 is the registry number for 2-Amine-3-Chloro p-Anisidine. Offered by: TRC. Available pack sizes: 250mg.
3-chloro-1-N-(4-methoxyphenyl)benzene-1,2-diamine (CAS 1443358-33-5) is a chemical compound with the molecular formula C13H13ClN2O and a molecular weight of 248.71 g/mol. IUPAC name: 3-chloro-1-N-(4-methoxyphenyl)benzene-1,2-diamine. InChIKey: CXBIHIAMQXURBR-UHFFFAOYSA-N.
| Molecular formula | C13H13ClN2O |
|---|---|
| Molecular weight | 248.71 g/mol |
| IUPAC name | 3-chloro-1-N-(4-methoxyphenyl)benzene-1,2-diamine |
| InChIKey | CXBIHIAMQXURBR-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)NC2=C(C(=CC=C2)Cl)N |
Computed by PubChem (NCBI)