CAS 1443981-57-4 appears in our catalog under these names: N-(1-Cyano-1-methylethyl)-2,2,2-trifluoro-N-methylacetamide, 95%, N-(1-Cyano-1-methylethyl)-2,2,2-trifluoro-N-methylacetamide. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 0,5g, 50mg.
N-(2-cyanopropan-2-yl)-2,2,2-trifluoro-N-methylacetamide (CAS 1443981-57-4) is a chemical compound with the molecular formula C7H9F3N2O and a molecular weight of 194.15 g/mol. IUPAC name: N-(2-cyanopropan-2-yl)-2,2,2-trifluoro-N-methylacetamide. InChIKey: ONCLRBWDDLZQNT-UHFFFAOYSA-N.
| Molecular formula | C7H9F3N2O |
|---|---|
| Molecular weight | 194.15 g/mol |
| IUPAC name | N-(2-cyanopropan-2-yl)-2,2,2-trifluoro-N-methylacetamide |
| InChIKey | ONCLRBWDDLZQNT-UHFFFAOYSA-N |
| SMILES | CC(C)(C#N)N(C)C(=O)C(F)(F)F |
Computed by PubChem (NCBI)