CAS 1443981-93-8 appears in our catalog under these names: 4-(Oxan-3-yl)benzoic acid, 98%, 4-(Oxan-3-yl)benzoic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 0,5g, 50mg.
4-(oxan-3-yl)benzoic acid (CAS 1443981-93-8) is a chemical compound with the molecular formula C12H14O3 and a molecular weight of 206.24 g/mol. IUPAC name: 4-(oxan-3-yl)benzoic acid. InChIKey: JYPYCJJRDTYMQO-UHFFFAOYSA-N.
| Molecular formula | C12H14O3 |
|---|---|
| Molecular weight | 206.24 g/mol |
| IUPAC name | 4-(oxan-3-yl)benzoic acid |
| InChIKey | JYPYCJJRDTYMQO-UHFFFAOYSA-N |
| SMILES | C1CC(COC1)C2=CC=C(C=C2)C(=O)O |
Computed by PubChem (NCBI)