CAS 1443983-84-3 appears in our catalog under these names: 3-(Fluoromethyl)azetidine trifluoroacetate, 3-(FLUOROMETHYL)AZETIDINE TFA, 98%, 3-(fluoromethyl)azetidine, trifluoroacetic acid, 98%, 3-(Fluoromethyl)azetidine trifluoroacetic acid, 98%, 98%. Offered by: Biosynth, Fluorochem, AmBeed, Chemat. Available pack sizes: 5g, 0,5g, 100mg, 250mg, 1g.
3-(fluoromethyl)azetidine;2,2,2-trifluoroacetic acid (CAS 1443983-84-3) is a chemical compound with the molecular formula C6H9F4NO2 and a molecular weight of 203.13 g/mol. IUPAC name: 3-(fluoromethyl)azetidine;2,2,2-trifluoroacetic acid. InChIKey: GEKBIXJKXKSUDP-UHFFFAOYSA-N.
| Molecular formula | C6H9F4NO2 |
|---|---|
| Molecular weight | 203.13 g/mol |
| IUPAC name | 3-(fluoromethyl)azetidine;2,2,2-trifluoroacetic acid |
| InChIKey | GEKBIXJKXKSUDP-UHFFFAOYSA-N |
| SMILES | C1C(CN1)CF.C(=O)(C(F)(F)F)O |
Computed by PubChem (NCBI)