CAS 2843613-99-8 is the registry number for (2S,3S)-3-Fluoro-2-methylazetidine 2,2,2-trifluoroacetate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(2S,3S)-3-fluoro-2-methylazetidine;2,2,2-trifluoroacetic acid (CAS 2843613-99-8) is a chemical compound with the molecular formula C6H9F4NO2 and a molecular weight of 203.13 g/mol. IUPAC name: (2S,3S)-3-fluoro-2-methylazetidine;2,2,2-trifluoroacetic acid. InChIKey: DMFACBXVOVKKDI-MMALYQPHSA-N.
| Molecular formula | C6H9F4NO2 |
|---|---|
| Molecular weight | 203.13 g/mol |
| IUPAC name | (2S,3S)-3-fluoro-2-methylazetidine;2,2,2-trifluoroacetic acid |
| InChIKey | DMFACBXVOVKKDI-MMALYQPHSA-N |
| SMILES | C[C@H]1[C@H](CN1)F.C(=O)(C(F)(F)F)O |
Computed by PubChem (NCBI)