CAS 2227206-76-8 appears in our catalog under these names: 2-(Fluoromethyl)azetidine trifluoroacetic acid, 95%, 2-(fluoromethyl)azetidine, trifluoroacetic acid, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 1g, 100mg, 250mg, 5g.
2-(fluoromethyl)azetidine;2,2,2-trifluoroacetic acid (CAS 2227206-76-8) is a chemical compound with the molecular formula C6H9F4NO2 and a molecular weight of 203.13 g/mol. IUPAC name: 2-(fluoromethyl)azetidine;2,2,2-trifluoroacetic acid. InChIKey: UYIMXDUXSJWJOJ-UHFFFAOYSA-N.
| Molecular formula | C6H9F4NO2 |
|---|---|
| Molecular weight | 203.13 g/mol |
| IUPAC name | 2-(fluoromethyl)azetidine;2,2,2-trifluoroacetic acid |
| InChIKey | UYIMXDUXSJWJOJ-UHFFFAOYSA-N |
| SMILES | C1CNC1CF.C(=O)(C(F)(F)F)O |
Computed by PubChem (NCBI)