CAS 14452-34-7 appears in our catalog under these names: 2,4-Dimethyl-6-nitrophenol, 98%, 2,4-Dimethyl-6-nitrophenol, 98% , 2,4-Dimethyl-6-nitrophenol, >98.0%(GC)(T), 2,4-Dimethyl-6-nitrophenol, 98%, 98%. Offered by: Combi-blocks, Thermo Scientific (Alfa Aesar), TCI, Chemat, Fluorochem. Available pack sizes: 25g, 100g, 1g, 5g, 10g.
2,4-dimethyl-6-nitrophenol (CAS 14452-34-7) is a chemical compound with the molecular formula C8H9NO3 and a molecular weight of 167.16 g/mol. IUPAC name: 2,4-dimethyl-6-nitrophenol. InChIKey: KJRCHILWKQLEBC-UHFFFAOYSA-N.
| Molecular formula | C8H9NO3 |
|---|---|
| Molecular weight | 167.16 g/mol |
| IUPAC name | 2,4-dimethyl-6-nitrophenol |
| InChIKey | KJRCHILWKQLEBC-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C(=C1)[N+](=O)[O-])O)C |
Computed by PubChem (NCBI)