CAS 144537-05-3 appears in our catalog under these names: N–Methyl–5–phenylisoxazole–3–carboxamide, N-Methyl-5-phenyl-3-isoxazolecarboxamide, 96%. Offered by: GLPBio, Combi-blocks. Available pack sizes: 1g, 250mg, 5g.
N-methyl-5-phenyl-1,2-oxazole-3-carboxamide (CAS 144537-05-3) is a chemical compound with the molecular formula C11H10N2O2 and a molecular weight of 202.21 g/mol. IUPAC name: N-methyl-5-phenyl-1,2-oxazole-3-carboxamide. InChIKey: MOMKSFSROUJANN-UHFFFAOYSA-N.
| Molecular formula | C11H10N2O2 |
|---|---|
| Molecular weight | 202.21 g/mol |
| IUPAC name | N-methyl-5-phenyl-1,2-oxazole-3-carboxamide |
| InChIKey | MOMKSFSROUJANN-UHFFFAOYSA-N |
| SMILES | CNC(=O)C1=NOC(=C1)C2=CC=CC=C2 |
Computed by PubChem (NCBI)