Products 144538-22-7
CAS 144538-22-7 appears in our catalog under these names: (5S，6R)–5，6–Diphenyl–2–morpholinone, (5S,6R)-5,6-Diphenyl-2-morpholinone, 97%. Offered by: GLPBio, Fluorochem, Chemat. Available pack sizes: 1g, 250mg, 5g, 100mg, 10g.
(5S,6R)-5,6-diphenylmorpholin-2-one (CAS 144538-22-7) is a chemical compound with the molecular formula C16H15NO2 and a molecular weight of 253.29 g/mol. IUPAC name: (5S,6R)-5,6-diphenylmorpholin-2-one. InChIKey: LTPOSIZJPSDSIL-JKSUJKDBSA-N.
| Molecular formula | C16H15NO2 |
|---|---|
| Molecular weight | 253.29 g/mol |
| IUPAC name | (5S,6R)-5,6-diphenylmorpholin-2-one |
| InChIKey | LTPOSIZJPSDSIL-JKSUJKDBSA-N |
| SMILES | C1C(=O)O[C@@H]([C@@H](N1)C2=CC=CC=C2)C3=CC=CC=C3 |
Computed by PubChem (NCBI)