CAS 1445592-86-8 appears in our catalog under these names: Saxagliptin Impurity 10, Saxagliptin Impurity 27, tert-Butyl (1R,3S,5R)-3-Carbamoyl-2-azabicyclo(3.1.0)hexane-2-carboxylate. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 100mg.
Tert-butyl (1R,3S,5R)-3-carbamoyl-2-azabicyclo[3.1.0]hexane-2-carboxylate (CAS 1445592-86-8) is a chemical compound with the molecular formula C11H18N2O3 and a molecular weight of 226.27 g/mol. IUPAC name: tert-butyl (1R,3S,5R)-3-carbamoyl-2-azabicyclo[3.1.0]hexane-2-carboxylate. InChIKey: VLAGXRRGXCNITB-PRJMDXOYSA-N.
| Molecular formula | C11H18N2O3 |
|---|---|
| Molecular weight | 226.27 g/mol |
| IUPAC name | tert-butyl (1R,3S,5R)-3-carbamoyl-2-azabicyclo[3.1.0]hexane-2-carboxylate |
| InChIKey | VLAGXRRGXCNITB-PRJMDXOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1[C@@H]2C[C@@H]2C[C@H]1C(=O)N |
Computed by PubChem (NCBI)