CAS 1523348-12-0 is the registry number for rel-(1S,3S,5S)-tert-Butyl 3-carbamoyl-2-azabicyclo(3.1.0)hexane-2-carboxylate, 97%. Offered by: AmBeed. Available pack sizes: 1g, 5g.
Tert-butyl (1S,3S,5S)-3-carbamoyl-2-azabicyclo[3.1.0]hexane-2-carboxylate (CAS 1523348-12-0) is a chemical compound with the molecular formula C11H18N2O3 and a molecular weight of 226.27 g/mol. IUPAC name: tert-butyl (1S,3S,5S)-3-carbamoyl-2-azabicyclo[3.1.0]hexane-2-carboxylate. InChIKey: VLAGXRRGXCNITB-FXQIFTODSA-N.
| Molecular formula | C11H18N2O3 |
|---|---|
| Molecular weight | 226.27 g/mol |
| IUPAC name | tert-butyl (1S,3S,5S)-3-carbamoyl-2-azabicyclo[3.1.0]hexane-2-carboxylate |
| InChIKey | VLAGXRRGXCNITB-FXQIFTODSA-N |
| SMILES | CC(C)(C)OC(=O)N1[C@H]2C[C@H]2C[C@H]1C(=O)N |
Computed by PubChem (NCBI)