CAS 144574-97-0 appears in our catalog under these names: Fmoc-Pro-D-Ala-OH, 95%, Fmoc-L-Pro-D-Ala-OH. Offered by: Chemat Brand, Iris Biotech. Available pack sizes: on request, 5g, 25g.
(2R)-2-[[(2S)-1-(9H-fluoren-9-ylmethoxycarbonyl)pyrrolidine-2-carbonyl]amino]propanoic acid (CAS 144574-97-0) is a chemical compound with the molecular formula C23H24N2O5 and a molecular weight of 408.4 g/mol. IUPAC name: (2R)-2-[[(2S)-1-(9H-fluoren-9-ylmethoxycarbonyl)pyrrolidine-2-carbonyl]amino]propanoic acid. InChIKey: IBWBVBRWVISRRH-VLIAUNLRSA-N.
| Molecular formula | C23H24N2O5 |
|---|---|
| Molecular weight | 408.4 g/mol |
| IUPAC name | (2R)-2-[[(2S)-1-(9H-fluoren-9-ylmethoxycarbonyl)pyrrolidine-2-carbonyl]amino]propanoic acid |
| InChIKey | IBWBVBRWVISRRH-VLIAUNLRSA-N |
| SMILES | C[C@H](C(=O)O)NC(=O)[C@@H]1CCCN1C(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24 |
Computed by PubChem (NCBI)