CAS 2171246-67-4 appears in our catalog under these names: Fmoc-beta-Ala-Pro-OH, Fmoc-β-Ala-Pro-OH, ≥95%, ≥95%. Offered by: TRC, Chemat. Available pack sizes: 1g, 250mg, 10g.
(2S)-1-[3-(9H-fluoren-9-ylmethoxycarbonylamino)propanoyl]pyrrolidine-2-carboxylic acid (CAS 2171246-67-4) is a chemical compound with the molecular formula C23H24N2O5 and a molecular weight of 408.4 g/mol. IUPAC name: (2S)-1-[3-(9H-fluoren-9-ylmethoxycarbonylamino)propanoyl]pyrrolidine-2-carboxylic acid. InChIKey: CMHMPGGPDZCPKV-FQEVSTJZSA-N.
| Molecular formula | C23H24N2O5 |
|---|---|
| Molecular weight | 408.4 g/mol |
| IUPAC name | (2S)-1-[3-(9H-fluoren-9-ylmethoxycarbonylamino)propanoyl]pyrrolidine-2-carboxylic acid |
| InChIKey | CMHMPGGPDZCPKV-FQEVSTJZSA-N |
| SMILES | C1C[C@H](N(C1)C(=O)CCNC(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24)C(=O)O |
Computed by PubChem (NCBI)