CAS 186023-44-9 appears in our catalog under these names: (S)-1-((S)-2-((((9H-Fluoren-9-yl)methoxy)carbonyl)amino)propanoyl)pyrrolidine-2-carboxylic acid, 97%, Fmoc–Ala–Pro–OH, Fmoc-L-Ala-L-Pro-OH, Fmoc-Ala-Pro-OH, Fmoc-Ala-Pro-OH, 97%. Offered by: Chemat Brand, GLPBio, Iris Biotech, Biosynth, MedChemExpress. Available pack sizes: on request, 1g, 5g, 25g, 10000mg, 5000mg, 5 g, 100 mg.
(2S)-1-[(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoyl]pyrrolidine-2-carboxylic acid (CAS 186023-44-9) is a chemical compound with the molecular formula C23H24N2O5 and a molecular weight of 408.4 g/mol. IUPAC name: (2S)-1-[(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoyl]pyrrolidine-2-carboxylic acid. InChIKey: HLFCRSYTJCARCY-XOBRGWDASA-N.
| Molecular formula | C23H24N2O5 |
|---|---|
| Molecular weight | 408.4 g/mol |
| IUPAC name | (2S)-1-[(2S)-2-(9H-fluoren-9-ylmethoxycarbonylamino)propanoyl]pyrrolidine-2-carboxylic acid |
| InChIKey | HLFCRSYTJCARCY-XOBRGWDASA-N |
| SMILES | C[C@@H](C(=O)N1CCC[C@H]1C(=O)O)NC(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24 |
Computed by PubChem (NCBI)