CAS 1445862-22-5 is the registry number for 5,7-Difluoroisoindolin-1-one, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 100mg, 250mg.
5,7-difluoro-2,3-dihydroisoindol-1-one (CAS 1445862-22-5) is a chemical compound with the molecular formula C8H5F2NO and a molecular weight of 169.13 g/mol. IUPAC name: 5,7-difluoro-2,3-dihydroisoindol-1-one. InChIKey: VISQWNPAUCDBNF-UHFFFAOYSA-N.
| Molecular formula | C8H5F2NO |
|---|---|
| Molecular weight | 169.13 g/mol |
| IUPAC name | 5,7-difluoro-2,3-dihydroisoindol-1-one |
| InChIKey | VISQWNPAUCDBNF-UHFFFAOYSA-N |
| SMILES | C1C2=C(C(=CC(=C2)F)F)C(=O)N1 |
Computed by PubChem (NCBI)