Products 197067-27-9
CAS 197067-27-9 appears in our catalog under these names: 3,3-Difluoroindolin-2-one, 95%, 3,3-Difluoroindolin-2-one, 95+%, 3,3-Difluoroindolin-2-one, >97%, >97%, 3,3-Difluoroindolin-2-one. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 250mg, 100mg, 10g, 500mg.
3,3-difluoro-1H-indol-2-one (CAS 197067-27-9) is a chemical compound with the molecular formula C8H5F2NO and a molecular weight of 169.13 g/mol. IUPAC name: 3,3-difluoro-1H-indol-2-one. InChIKey: AORVPBLZSJVLCI-UHFFFAOYSA-N.
| Molecular formula | C8H5F2NO |
|---|---|
| Molecular weight | 169.13 g/mol |
| IUPAC name | 3,3-difluoro-1H-indol-2-one |
| InChIKey | AORVPBLZSJVLCI-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(C(=O)N2)(F)F |
Computed by PubChem (NCBI)