CAS 1445891-41-7 is the registry number for tert-Butyl 8-bromo-5-fluoro-3,4-dihydroisoquinoline-2(1H)-carboxylate, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl 8-bromo-5-fluoro-3,4-dihydro-1H-isoquinoline-2-carboxylate (CAS 1445891-41-7) is a chemical compound with the molecular formula C14H17BrFNO2 and a molecular weight of 330.19 g/mol. IUPAC name: tert-butyl 8-bromo-5-fluoro-3,4-dihydro-1H-isoquinoline-2-carboxylate. InChIKey: MWOMZKZOLRYSPU-UHFFFAOYSA-N.
| Molecular formula | C14H17BrFNO2 |
|---|---|
| Molecular weight | 330.19 g/mol |
| IUPAC name | tert-butyl 8-bromo-5-fluoro-3,4-dihydro-1H-isoquinoline-2-carboxylate |
| InChIKey | MWOMZKZOLRYSPU-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC2=C(C=CC(=C2C1)Br)F |
Computed by PubChem (NCBI)