Products 2891580-89-3
CAS 2891580-89-3 is the registry number for tert-butyl N-[(1S,2R)-2-(4-bromo-3-fluoro-phenyl)cyclopropyl]carbamate, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g.
Tert-butyl N-[(1S,2R)-2-(4-bromo-3-fluorophenyl)cyclopropyl]carbamate (CAS 2891580-89-3) is a chemical compound with the molecular formula C14H17BrFNO2 and a molecular weight of 330.19 g/mol. IUPAC name: tert-butyl N-[(1S,2R)-2-(4-bromo-3-fluorophenyl)cyclopropyl]carbamate. InChIKey: XPECWUJIJQYFFM-SKDRFNHKSA-N.
| Molecular formula | C14H17BrFNO2 |
|---|---|
| Molecular weight | 330.19 g/mol |
| IUPAC name | tert-butyl N-[(1S,2R)-2-(4-bromo-3-fluorophenyl)cyclopropyl]carbamate |
| InChIKey | XPECWUJIJQYFFM-SKDRFNHKSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@H]1C[C@@H]1C2=CC(=C(C=C2)Br)F |
Computed by PubChem (NCBI)