CAS 2058040-86-9 is the registry number for tert-Butyl 6-bromo-5-fluoro-3,4-dihydroisoquinoline-2(1H)-carboxylate, 98%. Offered by: AmBeed. Available pack sizes: 1g, 5g.
Tert-butyl 6-bromo-5-fluoro-3,4-dihydro-1H-isoquinoline-2-carboxylate (CAS 2058040-86-9) is a chemical compound with the molecular formula C14H17BrFNO2 and a molecular weight of 330.19 g/mol. IUPAC name: tert-butyl 6-bromo-5-fluoro-3,4-dihydro-1H-isoquinoline-2-carboxylate. InChIKey: IUWKKLSQJWFZOT-UHFFFAOYSA-N.
| Molecular formula | C14H17BrFNO2 |
|---|---|
| Molecular weight | 330.19 g/mol |
| IUPAC name | tert-butyl 6-bromo-5-fluoro-3,4-dihydro-1H-isoquinoline-2-carboxylate |
| InChIKey | IUWKKLSQJWFZOT-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC2=C(C1)C=CC(=C2F)Br |
Computed by PubChem (NCBI)