Products 1445951-77-8
CAS 1445951-77-8 is the registry number for Racemic-(3r,5s)-tert-butyl 3-hydroxy-1-oxa-7-azaspiro[4.4]nonane-7-carboxylate, 97%, 97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 500mg, 1g.
Tert-butyl (3R,5S)-3-hydroxy-1-oxa-7-azaspiro[4.4]nonane-7-carboxylate (CAS 1445951-77-8) is a chemical compound with the molecular formula C12H21NO4 and a molecular weight of 243.30 g/mol. IUPAC name: tert-butyl (3R,5S)-3-hydroxy-1-oxa-7-azaspiro[4.4]nonane-7-carboxylate. InChIKey: QMWZANYLPBQFME-SKDRFNHKSA-N.
| Molecular formula | C12H21NO4 |
|---|---|
| Molecular weight | 243.30 g/mol |
| IUPAC name | tert-butyl (3R,5S)-3-hydroxy-1-oxa-7-azaspiro[4.4]nonane-7-carboxylate |
| InChIKey | QMWZANYLPBQFME-SKDRFNHKSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC[C@@]2(C1)C[C@H](CO2)O |
Computed by PubChem (NCBI)