CAS 1446478-22-3 appears in our catalog under these names: (S)-2-((((9H-Fluoren-9-yl)methoxy)carbonyl)(methyl)amino)-3-(thiazol-4-yl)propanoic acid, 98%, 98%, Fmoc-N-Me-Ala(4-Thz)-OH, 98%. Offered by: Chemat, Fluorochem, Ambeed. Available pack sizes: 250mg, 100mg, 1g, 5g, 10g, 25g.
(2S)-2-[9H-fluoren-9-ylmethoxycarbonyl(methyl)amino]-3-(1,3-thiazol-4-yl)propanoic acid (CAS 1446478-22-3) is a chemical compound with the molecular formula C22H20N2O4S and a molecular weight of 408.5 g/mol. IUPAC name: (2S)-2-[9H-fluoren-9-ylmethoxycarbonyl(methyl)amino]-3-(1,3-thiazol-4-yl)propanoic acid. InChIKey: WNURNGNZUJQTEL-FQEVSTJZSA-N.
| Molecular formula | C22H20N2O4S |
|---|---|
| Molecular weight | 408.5 g/mol |
| IUPAC name | (2S)-2-[9H-fluoren-9-ylmethoxycarbonyl(methyl)amino]-3-(1,3-thiazol-4-yl)propanoic acid |
| InChIKey | WNURNGNZUJQTEL-FQEVSTJZSA-N |
| SMILES | CN([C@@H](CC1=CSC=N1)C(=O)O)C(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24 |
Computed by PubChem (NCBI)