CAS 2138372-34-4 is the registry number for 2-(2-(2-{((9H-Fluoren-9-ylmethoxy)carbonyl)amino}ethyl)-1,3-thiazol-4-yl)acetic acid. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
2-[2-[2-(9H-fluoren-9-ylmethoxycarbonylamino)ethyl]-1,3-thiazol-4-yl]acetic acid (CAS 2138372-34-4) is a chemical compound with the molecular formula C22H20N2O4S and a molecular weight of 408.5 g/mol. IUPAC name: 2-[2-[2-(9H-fluoren-9-ylmethoxycarbonylamino)ethyl]-1,3-thiazol-4-yl]acetic acid. InChIKey: GXIRZXZBHDXTLC-UHFFFAOYSA-N.
| Molecular formula | C22H20N2O4S |
|---|---|
| Molecular weight | 408.5 g/mol |
| IUPAC name | 2-[2-[2-(9H-fluoren-9-ylmethoxycarbonylamino)ethyl]-1,3-thiazol-4-yl]acetic acid |
| InChIKey | GXIRZXZBHDXTLC-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(C3=CC=CC=C32)COC(=O)NCCC4=NC(=CS4)CC(=O)O |
Computed by PubChem (NCBI)