CAS 1446478-31-4 appears in our catalog under these names: (4R)-1-Fmoc-4-ethoxy-L-proline, 98%, Fmoc-Hyp(Et)-OH, 95%. Offered by: Fluorochem, Ambeed. Available pack sizes: 100mg, 250mg, 1g, 5g, 50mg, 25mg.
(2S,4R)-4-ethoxy-1-(9H-fluoren-9-ylmethoxycarbonyl)pyrrolidine-2-carboxylic acid (CAS 1446478-31-4) is a chemical compound with the molecular formula C22H23NO5 and a molecular weight of 381.4 g/mol. IUPAC name: (2S,4R)-4-ethoxy-1-(9H-fluoren-9-ylmethoxycarbonyl)pyrrolidine-2-carboxylic acid. InChIKey: GANZFSNGFPNJGI-VLIAUNLRSA-N.
| Molecular formula | C22H23NO5 |
|---|---|
| Molecular weight | 381.4 g/mol |
| IUPAC name | (2S,4R)-4-ethoxy-1-(9H-fluoren-9-ylmethoxycarbonyl)pyrrolidine-2-carboxylic acid |
| InChIKey | GANZFSNGFPNJGI-VLIAUNLRSA-N |
| SMILES | CCO[C@@H]1C[C@H](N(C1)C(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24)C(=O)O |
Computed by PubChem (NCBI)