CAS 1446478-35-8 is the registry number for Methyl (4E)-5-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)-4-pentenoate. Offered by: TRC. Available pack sizes: 250mg.
Methyl (E)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pent-4-enoate (CAS 1446478-35-8) is a chemical compound with the molecular formula C12H21BO4 and a molecular weight of 240.11 g/mol. IUPAC name: methyl (E)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pent-4-enoate. InChIKey: SRCMNYPFDGLNFM-VQHVLOKHSA-N.
| Molecular formula | C12H21BO4 |
|---|---|
| Molecular weight | 240.11 g/mol |
| IUPAC name | methyl (E)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pent-4-enoate |
| InChIKey | SRCMNYPFDGLNFM-VQHVLOKHSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)/C=C/CCC(=O)OC |
Computed by PubChem (NCBI)