CAS 2746332-54-5 is the registry number for Methyl (Z)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pent-4-enoate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl (Z)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pent-4-enoate (CAS 2746332-54-5) is a chemical compound with the molecular formula C12H21BO4 and a molecular weight of 240.11 g/mol. IUPAC name: methyl (Z)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pent-4-enoate. InChIKey: SRCMNYPFDGLNFM-CLFYSBASSA-N.
| Molecular formula | C12H21BO4 |
|---|---|
| Molecular weight | 240.11 g/mol |
| IUPAC name | methyl (Z)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)pent-4-enoate |
| InChIKey | SRCMNYPFDGLNFM-CLFYSBASSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)/C=C\CCC(=O)OC |
Computed by PubChem (NCBI)