Products 2417259-34-6
CAS 2417259-34-6 is the registry number for Ethyl (E)-2-methyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)acrylate, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
Ethyl (E)-2-methyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enoate (CAS 2417259-34-6) is a chemical compound with the molecular formula C12H21BO4 and a molecular weight of 240.11 g/mol. IUPAC name: ethyl (E)-2-methyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enoate. InChIKey: KBLNRJZXZPSOTF-CMDGGOBGSA-N.
| Molecular formula | C12H21BO4 |
|---|---|
| Molecular weight | 240.11 g/mol |
| IUPAC name | ethyl (E)-2-methyl-3-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)prop-2-enoate |
| InChIKey | KBLNRJZXZPSOTF-CMDGGOBGSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)/C=C(\C)/C(=O)OCC |
Computed by PubChem (NCBI)