CAS 1446509-45-0 is the registry number for 3-(1-AZETIDINYLSULFONYL)BENZENAMINE, 95%, 95%. Offered by: Chemat. Available pack sizes: 10mg, 25mg, 50mg.
3-(azetidin-1-ylsulfonyl)aniline (CAS 1446509-45-0) is a chemical compound with the molecular formula C9H12N2O2S and a molecular weight of 212.27 g/mol. IUPAC name: 3-(azetidin-1-ylsulfonyl)aniline. InChIKey: ADLCQKUPYRRLHC-UHFFFAOYSA-N.
| Molecular formula | C9H12N2O2S |
|---|---|
| Molecular weight | 212.27 g/mol |
| IUPAC name | 3-(azetidin-1-ylsulfonyl)aniline |
| InChIKey | ADLCQKUPYRRLHC-UHFFFAOYSA-N |
| SMILES | C1CN(C1)S(=O)(=O)C2=CC=CC(=C2)N |
Computed by PubChem (NCBI)