CAS 144653-45-2 is the registry number for N-4-Biphenylyl-beta-alanine, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
3-(4-phenylanilino)propanoic acid (CAS 144653-45-2) is a chemical compound with the molecular formula C15H15NO2 and a molecular weight of 241.28 g/mol. IUPAC name: 3-(4-phenylanilino)propanoic acid. InChIKey: URQKONWODPRUBS-UHFFFAOYSA-N.
| Molecular formula | C15H15NO2 |
|---|---|
| Molecular weight | 241.28 g/mol |
| IUPAC name | 3-(4-phenylanilino)propanoic acid |
| InChIKey | URQKONWODPRUBS-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)C2=CC=C(C=C2)NCCC(=O)O |
Computed by PubChem (NCBI)