CAS 1446947-99-4 is the registry number for (S)-2-(2-(Difluoromethyl)-4-methoxy-5-methylphenyl)pyrrolidine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
(2S)-2-[2-(difluoromethyl)-4-methoxy-5-methylphenyl]pyrrolidine (CAS 1446947-99-4) is a chemical compound with the molecular formula C13H17F2NO and a molecular weight of 241.28 g/mol. IUPAC name: (2S)-2-[2-(difluoromethyl)-4-methoxy-5-methylphenyl]pyrrolidine. InChIKey: PIHFJOVPDSAKGY-NSHDSACASA-N.
| Molecular formula | C13H17F2NO |
|---|---|
| Molecular weight | 241.28 g/mol |
| IUPAC name | (2S)-2-[2-(difluoromethyl)-4-methoxy-5-methylphenyl]pyrrolidine |
| InChIKey | PIHFJOVPDSAKGY-NSHDSACASA-N |
| SMILES | CC1=CC(=C(C=C1OC)C(F)F)[C@@H]2CCCN2 |
Computed by PubChem (NCBI)