CAS 2378854-77-2 is the registry number for (R)-(1-Benzyl-4,4-difluoropiperidin-3-yl)methanol, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
[(3R)-1-benzyl-4,4-difluoropiperidin-3-yl]methanol (CAS 2378854-77-2) is a chemical compound with the molecular formula C13H17F2NO and a molecular weight of 241.28 g/mol. IUPAC name: [(3R)-1-benzyl-4,4-difluoropiperidin-3-yl]methanol. InChIKey: DMXXITLTOBWYSU-GFCCVEGCSA-N.
| Molecular formula | C13H17F2NO |
|---|---|
| Molecular weight | 241.28 g/mol |
| IUPAC name | [(3R)-1-benzyl-4,4-difluoropiperidin-3-yl]methanol |
| InChIKey | DMXXITLTOBWYSU-GFCCVEGCSA-N |
| SMILES | C1CN(C[C@@H](C1(F)F)CO)CC2=CC=CC=C2 |
Computed by PubChem (NCBI)